C24H34N2 — CID 176877463
(2R)-4-benzhydryl-2-tert-butyl-1-propan-2-ylpiperazine (PubChem CID 176877463) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is (2R)-4-benzhydryl-2-tert-butyl-1-propan-2-ylpiperazine.
| Compound Name | (2R)-4-benzhydryl-2-tert-butyl-1-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 176877463 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | (2R)-4-benzhydryl-2-tert-butyl-1-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(C(c2ccccc2)c2ccccc2)C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C24H34N2/c1-19(2)26-17-16-25(18-22(26)24(3,4)5)23(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19,22-23H,16-18H2,1-5H3/t22-/m0/s1 |
| InChIKey | SCHDGMJPWIWCEF-QFIPXVFZSA-N |
| XLogP | 5.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |