C26H36O4 — CID 59265327
2-methyl-1-[4-(4-methylcyclohexyl)oxybutoxy]-4-[(4-methylphenyl)peroxymethyl]benzene (PubChem CID 59265327) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-methyl-1-[4-(4-methylcyclohexyl)oxybutoxy]-4-[(4-methylphenyl)peroxymethyl]benzene.
| Compound Name | 2-methyl-1-[4-(4-methylcyclohexyl)oxybutoxy]-4-[(4-methylphenyl)peroxymethyl]benzene |
|---|---|
| PubChem CID | 59265327 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-methyl-1-[4-(4-methylcyclohexyl)oxybutoxy]-4-[(4-methylphenyl)peroxymethyl]benzene |
| SMILES | Cc1ccc(OOCc2ccc(OCCCCOC3CCC(C)CC3)c(C)c2)cc1 |
| InChI | InChI=1S/C26H36O4/c1-20-6-11-24(12-7-20)27-16-4-5-17-28-26-15-10-23(18-22(26)3)19-29-30-25-13-8-21(2)9-14-25/h8-10,13-15,18,20,24H,4-7,11-12,16-17,19H2,1-3H3 |
| InChIKey | ZEOCKZZOXVDLPJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|