C32H38F2O — CID 59931486
2-(3,4-difluorophenyl)-5-[2,6-dimethyl-4-[3-(4-methylcyclohexyl)oxypropyl]phenyl]-1,3-dimethylbenzene (PubChem CID 59931486) has the molecular formula C32H38F2O and a molecular weight of 476.65 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-[2,6-dimethyl-4-[3-(4-methylcyclohexyl)oxypropyl]phenyl]-1,3-dimethylbenzene.
| Compound Name | 2-(3,4-difluorophenyl)-5-[2,6-dimethyl-4-[3-(4-methylcyclohexyl)oxypropyl]phenyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 59931486 |
| Molecular Formula | C32H38F2O |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-[2,6-dimethyl-4-[3-(4-methylcyclohexyl)oxypropyl]phenyl]-1,3-dimethylbenzene |
| SMILES | Cc1cc(CCCOC2CCC(C)CC2)cc(C)c1-c1cc(C)c(-c2ccc(F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C32H38F2O/c1-20-8-11-28(12-9-20)35-14-6-7-25-15-21(2)32(22(3)16-25)27-17-23(4)31(24(5)18-27)26-10-13-29(33)30(34)19-26/h10,13,15-20,28H,6-9,11-12,14H2,1-5H3 |
| InChIKey | FYWWXXBUQLIMCB-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|