C15H20F4O — CID 91374530
1-(fluoromethoxy)-4-methylcyclohexane;1,2,3-trifluoro-4-methylbenzene (PubChem CID 91374530) has the molecular formula C15H20F4O and a molecular weight of 292.32 g/mol. Its IUPAC name is 1-(fluoromethoxy)-4-methylcyclohexane;1,2,3-trifluoro-4-methylbenzene.
| Compound Name | 1-(fluoromethoxy)-4-methylcyclohexane;1,2,3-trifluoro-4-methylbenzene |
|---|---|
| PubChem CID | 91374530 |
| Molecular Formula | C15H20F4O |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-(fluoromethoxy)-4-methylcyclohexane;1,2,3-trifluoro-4-methylbenzene |
| SMILES | CC1CCC(OCF)CC1.Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C8H15FO.C7H5F3/c1-7-2-4-8(5-3-7)10-6-9;1-4-2-3-5(8)7(10)6(4)9/h7-8H,2-6H2,1H3;2-3H,1H3 |
| InChIKey | SELFXDHPELJWRY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|