C15H21F2O2+ — CID 142370670
[2,3-difluoro-4-[(4-methylcyclohexyl)oxymethyl]phenyl]methyloxidanium (PubChem CID 142370670) has the molecular formula C15H21F2O2+ and a molecular weight of 271.33 g/mol. Its IUPAC name is [2,3-difluoro-4-[(4-methylcyclohexyl)oxymethyl]phenyl]methyloxidanium.
| Compound Name | [2,3-difluoro-4-[(4-methylcyclohexyl)oxymethyl]phenyl]methyloxidanium |
|---|---|
| PubChem CID | 142370670 |
| Molecular Formula | C15H21F2O2+ |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | [2,3-difluoro-4-[(4-methylcyclohexyl)oxymethyl]phenyl]methyloxidanium |
| SMILES | CC1CCC(OCc2ccc(C[OH2+])c(F)c2F)CC1 |
| InChI | InChI=1S/C15H20F2O2/c1-10-2-6-13(7-3-10)19-9-12-5-4-11(8-18)14(16)15(12)17/h4-5,10,13,18H,2-3,6-9H2,1H3/p+1 |
| InChIKey | WYVLXCOWEBVFIR-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 32.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|