About difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene
difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene (PubChem CID 123965488) has the molecular formula C21H24F4O
and a molecular weight of 368.41 g/mol. Its IUPAC name is difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene.
Molecular Properties
| Compound Name | difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene |
| PubChem CID | 123965488 |
| Molecular Formula | C21H24F4O |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene |
| SMILES | Cc1ccc(Oc2ccc(C3CCC(C)CC3)cc2)c(F)c1F.FCF |
| InChI | InChI=1S/C20H22F2O.CH2F2/c1-13-3-6-15(7-4-13)16-8-10-17(11-9-16)23-18-12-5-14(2)19(21)20(18)22;2-1-3/h5,8-13,15H,3-4,6-7H2,1-2H3;1H2 |
| InChIKey | XGJKENGBAZXDFO-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene?
The IUPAC name of difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene (CID 123965488) is difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene.
What is the SMILES notation for difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene?
The canonical SMILES for difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene is Cc1ccc(Oc2ccc(C3CCC(C)CC3)cc2)c(F)c1F.FCF.
What is the InChIKey of difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene?
The InChIKey is XGJKENGBAZXDFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2O.CH2F2/c1-13-3-6-15(7-4-13)16-8-10-17(11-9-16)23-18-12-5-14(2)19(21)20(18)22;2-1-3/h5,8-13,15H,3-4,6-7H2,1-2H3;1H2.
What are the key properties of difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene?
difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene has a molecular weight of 368.41 g/mol, XLogP of 7.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethane;2,3-difluoro-1-methyl-4-[4-(4-methylcyclohexyl)phenoxy]benzene is sourced from PubChem (CID 123965488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).