About 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate
5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate (PubChem CID 69230771) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate.
Molecular Properties
| Compound Name | 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate |
| PubChem CID | 69230771 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOC(=O)C(=C)C1CCCCC1 |
| InChI | InChI=1S/C17H26O4/c1-3-16(18)20-12-8-5-9-13-21-17(19)14(2)15-10-6-4-7-11-15/h3,15H,1-2,4-13H2 |
| InChIKey | SVFKMACLTTZOPW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate?
The IUPAC name of 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate (CID 69230771) is 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate.
What is the SMILES notation for 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate?
The canonical SMILES for 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate is C=CC(=O)OCCCCCOC(=O)C(=C)C1CCCCC1.
What is the InChIKey of 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate?
The InChIKey is SVFKMACLTTZOPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4/c1-3-16(18)20-12-8-5-9-13-21-17(19)14(2)15-10-6-4-7-11-15/h3,15H,1-2,4-13H2.
What are the key properties of 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate?
5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate has a molecular weight of 294.39 g/mol, XLogP of 3.57, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enoyloxypentyl 2-cyclohexylprop-2-enoate is sourced from PubChem (CID 69230771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).