C29H46O6 — CID 145217147
6-[2-[4-[4-(prop-2-enoyloxymethyl)cyclohexyl]cyclohexyl]-1,3-dioxan-5-yl]hexyl prop-2-enoate (PubChem CID 145217147) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is 6-[2-[4-[4-(prop-2-enoyloxymethyl)cyclohexyl]cyclohexyl]-1,3-dioxan-5-yl]hexyl prop-2-enoate.
| Compound Name | 6-[2-[4-[4-(prop-2-enoyloxymethyl)cyclohexyl]cyclohexyl]-1,3-dioxan-5-yl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 145217147 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 6-[2-[4-[4-(prop-2-enoyloxymethyl)cyclohexyl]cyclohexyl]-1,3-dioxan-5-yl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCC1COC(C2CCC(C3CCC(COC(=O)C=C)CC3)CC2)OC1 |
| InChI | InChI=1S/C29H46O6/c1-3-27(30)32-18-8-6-5-7-9-23-20-34-29(35-21-23)26-16-14-25(15-17-26)24-12-10-22(11-13-24)19-33-28(31)4-2/h3-4,22-26,29H,1-2,5-21H2 |
| InChIKey | OSXJEQMEBUFKAQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|