C23H30F2O2 — CID 67643873
(E)-5-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]pent-2-enoic acid (PubChem CID 67643873) has the molecular formula C23H30F2O2 and a molecular weight of 376.49 g/mol. Its IUPAC name is (E)-5-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]pent-2-enoic acid.
| Compound Name | (E)-5-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 67643873 |
| Molecular Formula | C23H30F2O2 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (E)-5-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]pent-2-enoic acid |
| SMILES | O=C(O)/C=C/CCC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H30F2O2/c24-21-14-13-20(15-22(21)25)19-11-9-18(10-12-19)17-7-5-16(6-8-17)3-1-2-4-23(26)27/h2,4,13-19H,1,3,5-12H2,(H,26,27)/b4-2+ |
| InChIKey | OWKHSMHRPIIXKN-DUXPYHPUSA-N |
| XLogP | 6.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|