C22H33F2O4P — CID 101384531
4-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]butyl dihydrogen phosphate (PubChem CID 101384531) has the molecular formula C22H33F2O4P and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]butyl dihydrogen phosphate.
| Compound Name | 4-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]butyl dihydrogen phosphate |
|---|---|
| PubChem CID | 101384531 |
| Molecular Formula | C22H33F2O4P |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 4-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]butyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCCCC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H33F2O4P/c23-21-13-12-20(15-22(21)24)19-10-8-18(9-11-19)17-6-4-16(5-7-17)3-1-2-14-28-29(25,26)27/h12-13,15-19H,1-11,14H2,(H2,25,26,27) |
| InChIKey | TVLOZBMWQKEJPS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|