C28H48OSi — CID 153276993
3-[dimethyl-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]silyl]propan-1-ol (PubChem CID 153276993) has the molecular formula C28H48OSi and a molecular weight of 428.78 g/mol. Its IUPAC name is 3-[dimethyl-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]silyl]propan-1-ol.
| Compound Name | 3-[dimethyl-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]silyl]propan-1-ol |
|---|---|
| PubChem CID | 153276993 |
| Molecular Formula | C28H48OSi |
| Molecular Weight | 428.78 g/mol |
| Exact Mass | 428.35 |
| IUPAC Name | 3-[dimethyl-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]silyl]propan-1-ol |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc([Si](C)(C)CCCO)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H48OSi/c1-4-5-6-8-23-9-11-24(12-10-23)25-13-15-26(16-14-25)27-17-19-28(20-18-27)30(2,3)22-7-21-29/h17-20,23-26,29H,4-16,21-22H2,1-3H3 |
| InChIKey | UPZQVGRCYSCFOZ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.78 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|