C34H44F2OSi — CID 149428861
3-[[4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]-dimethylsilyl]propan-1-ol (PubChem CID 149428861) has the molecular formula C34H44F2OSi and a molecular weight of 534.81 g/mol. Its IUPAC name is 3-[[4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[[4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 149428861 |
| Molecular Formula | C34H44F2OSi |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 3-[[4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]-dimethylsilyl]propan-1-ol |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(-c4ccc([Si](C)(C)CCCO)cc4)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C34H44F2OSi/c1-4-5-6-8-25-9-11-26(12-10-25)27-13-15-28(16-14-27)31-21-22-32(34(36)33(31)35)29-17-19-30(20-18-29)38(2,3)24-7-23-37/h13-22,25-26,37H,4-12,23-24H2,1-3H3 |
| InChIKey | YUQOKFWLMKTABE-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|