C36H58O4 — CID 139457157
2-[4-[2-methyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexa-2,4-dien-1-yl]cyclohexyl]oxyethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 139457157) has the molecular formula C36H58O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is 2-[4-[2-methyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexa-2,4-dien-1-yl]cyclohexyl]oxyethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[2-methyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexa-2,4-dien-1-yl]cyclohexyl]oxyethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 139457157 |
| Molecular Formula | C36H58O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | 2-[4-[2-methyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexa-2,4-dien-1-yl]cyclohexyl]oxyethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOC1CCC(C2CC=C(C3CCC(C4CCC(CCCCC)CC4)CC3)C=C2C)CC1 |
| InChI | InChI=1S/C36H58O4/c1-4-5-6-7-28-8-10-29(11-9-28)30-12-14-31(15-13-30)33-18-21-35(26(2)24-33)32-16-19-34(20-17-32)39-22-23-40-36(38)27(3)25-37/h18,24,28-32,34-35,37H,3-17,19-23,25H2,1-2H3 |
| InChIKey | BFWVZQLTJCOYQS-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|