C42H58O7 — CID 146668707
[4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-(2-hydroxyprop-2-enoyloxymethyl)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylpropanoate (PubChem CID 146668707) has the molecular formula C42H58O7 and a molecular weight of 674.92 g/mol. Its IUPAC name is [4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-(2-hydroxyprop-2-enoyloxymethyl)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylpropanoate.
| Compound Name | [4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-(2-hydroxyprop-2-enoyloxymethyl)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 146668707 |
| Molecular Formula | C42H58O7 |
| Molecular Weight | 674.92 g/mol |
| Exact Mass | 674.42 |
| IUPAC Name | [4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-(2-hydroxyprop-2-enoyloxymethyl)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCC(CCc1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2)cc1CC)(COC(=O)C(=C)O)COC(=O)C(C)C |
| InChI | InChI=1S/C42H58O7/c1-8-10-11-12-32-13-15-34(16-14-32)35-17-19-36(20-18-35)38-22-21-37(33(9-2)25-38)23-24-42(26-47-39(44)29(3)4,27-48-40(45)30(5)6)28-49-41(46)31(7)43/h17-22,25,30,32,34,43H,3,7-16,23-24,26-28H2,1-2,4-6H3 |
| InChIKey | GHGYBAJAYSSNIA-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.92 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|