C31H52O6 — CID 145411275
[2-ethyl-2-(2-hydroxyprop-2-enoyloxymethyl)-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411275) has the molecular formula C31H52O6 and a molecular weight of 520.75 g/mol. Its IUPAC name is [2-ethyl-2-(2-hydroxyprop-2-enoyloxymethyl)-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-ethyl-2-(2-hydroxyprop-2-enoyloxymethyl)-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411275 |
| Molecular Formula | C31H52O6 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | [2-ethyl-2-(2-hydroxyprop-2-enoyloxymethyl)-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(O)C(=O)OCC(CC)(CCC1CCC(C2CCC(CCCCC)CC2)CC1)COC(=O)C(=C)CO |
| InChI | InChI=1S/C31H52O6/c1-5-7-8-9-25-10-14-27(15-11-25)28-16-12-26(13-17-28)18-19-31(6-2,22-37-30(35)24(4)33)21-36-29(34)23(3)20-32/h25-28,32-33H,3-22H2,1-2H3 |
| InChIKey | KTZVEPWOZCXWED-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|