C24H44O3 — CID 139457112
[4-(4-heptylcyclohexyl)cyclohexyl] 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 139457112) has the molecular formula C24H44O3 and a molecular weight of 380.61 g/mol. Its IUPAC name is [4-(4-heptylcyclohexyl)cyclohexyl] 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | [4-(4-heptylcyclohexyl)cyclohexyl] 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139457112 |
| Molecular Formula | C24H44O3 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | [4-(4-heptylcyclohexyl)cyclohexyl] 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | CCCCCCCC1CCC(C2CCC(OC(=O)C(C)(C)CO)CC2)CC1 |
| InChI | InChI=1S/C24H44O3/c1-4-5-6-7-8-9-19-10-12-20(13-11-19)21-14-16-22(17-15-21)27-23(26)24(2,3)18-25/h19-22,25H,4-18H2,1-3H3 |
| InChIKey | IQSGAEOWUMQBSG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|