C21H38O4 — CID 166645711
[4-(5-pentyloxan-2-yl)cyclohexyl] 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 166645711) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is [4-(5-pentyloxan-2-yl)cyclohexyl] 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | [4-(5-pentyloxan-2-yl)cyclohexyl] 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166645711 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | [4-(5-pentyloxan-2-yl)cyclohexyl] 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | CCCCCC1CCC(C2CCC(OC(=O)C(C)(C)CO)CC2)OC1 |
| InChI | InChI=1S/C21H38O4/c1-4-5-6-7-16-8-13-19(24-14-16)17-9-11-18(12-10-17)25-20(23)21(2,3)15-22/h16-19,22H,4-15H2,1-3H3 |
| InChIKey | SNJZUMXAFKFLBD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|