C35H62O6 — CID 139524848
[5-(2-methylprop-2-enoyloxy)-3-[[4-[3-(4-pentylcyclohexyl)propoxy]cyclohexyl]methyl]pentyl] 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 139524848) has the molecular formula C35H62O6 and a molecular weight of 578.88 g/mol. Its IUPAC name is [5-(2-methylprop-2-enoyloxy)-3-[[4-[3-(4-pentylcyclohexyl)propoxy]cyclohexyl]methyl]pentyl] 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | [5-(2-methylprop-2-enoyloxy)-3-[[4-[3-(4-pentylcyclohexyl)propoxy]cyclohexyl]methyl]pentyl] 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139524848 |
| Molecular Formula | C35H62O6 |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 578.45 |
| IUPAC Name | [5-(2-methylprop-2-enoyloxy)-3-[[4-[3-(4-pentylcyclohexyl)propoxy]cyclohexyl]methyl]pentyl] 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCC(CCOC(=O)C(C)(C)CO)CC1CCC(OCCCC2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C35H62O6/c1-6-7-8-10-28-12-14-29(15-13-28)11-9-22-39-32-18-16-30(17-19-32)25-31(20-23-40-33(37)27(2)3)21-24-41-34(38)35(4,5)26-36/h28-32,36H,2,6-26H2,1,3-5H3 |
| InChIKey | YXFWLSJDMJTNDG-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|