C29H50O7 — CID 142282727
2-(hydroxymethyl)prop-2-enal;[3-methoxy-2-[4-(4-pentoxycyclohexyl)cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 142282727) has the molecular formula C29H50O7 and a molecular weight of 510.71 g/mol. Its IUPAC name is 2-(hydroxymethyl)prop-2-enal;[3-methoxy-2-[4-(4-pentoxycyclohexyl)cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-(hydroxymethyl)prop-2-enal;[3-methoxy-2-[4-(4-pentoxycyclohexyl)cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 142282727 |
| Molecular Formula | C29H50O7 |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | 2-(hydroxymethyl)prop-2-enal;[3-methoxy-2-[4-(4-pentoxycyclohexyl)cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C=O)CO.C=C(CO)C(=O)OCC(COC)C1CCC(C2CCC(OCCCCC)CC2)CC1 |
| InChI | InChI=1S/C25H44O5.C4H6O2/c1-4-5-6-15-29-24-13-11-21(12-14-24)20-7-9-22(10-8-20)23(17-28-3)18-30-25(27)19(2)16-26;1-4(2-5)3-6/h20-24,26H,2,4-18H2,1,3H3;2,6H,1,3H2 |
| InChIKey | WDSAJEPPMIVDPY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|