C42H55ClO6 — CID 145412076
[2-[4-[4-[4-(3-chloro-4-pentylphenyl)phenyl]-3-ethylphenyl]cyclohexyl]-3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]propyl] 3-hydroxy-2-methylpropanoate (PubChem CID 145412076) has the molecular formula C42H55ClO6 and a molecular weight of 691.35 g/mol. Its IUPAC name is [2-[4-[4-[4-(3-chloro-4-pentylphenyl)phenyl]-3-ethylphenyl]cyclohexyl]-3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]propyl] 3-hydroxy-2-methylpropanoate.
| Compound Name | [2-[4-[4-[4-(3-chloro-4-pentylphenyl)phenyl]-3-ethylphenyl]cyclohexyl]-3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]propyl] 3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 145412076 |
| Molecular Formula | C42H55ClO6 |
| Molecular Weight | 691.35 g/mol |
| Exact Mass | 690.37 |
| IUPAC Name | [2-[4-[4-[4-(3-chloro-4-pentylphenyl)phenyl]-3-ethylphenyl]cyclohexyl]-3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]propyl] 3-hydroxy-2-methylpropanoate |
| SMILES | C=C(CO)C(O)OCC(COC(=O)C(C)CO)C1CCC(c2ccc(-c3ccc(-c4ccc(CCCCC)c(Cl)c4)cc3)c(CC)c2)CC1 |
| InChI | InChI=1S/C42H55ClO6/c1-5-7-8-9-35-18-19-37(23-40(35)43)32-14-16-34(17-15-32)39-21-20-36(22-30(39)6-2)31-10-12-33(13-11-31)38(26-48-41(46)28(3)24-44)27-49-42(47)29(4)25-45/h14-23,29,31,33,38,41,44-46H,3,5-13,24-27H2,1-2,4H3 |
| InChIKey | SFSRLHNYERRPJS-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.35 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|