C26H32F4O — CID 20705608
1-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-4-ethyl-2,3-difluorobenzene (PubChem CID 20705608) has the molecular formula C26H32F4O and a molecular weight of 436.53 g/mol. Its IUPAC name is 1-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-4-ethyl-2,3-difluorobenzene.
| Compound Name | 1-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-4-ethyl-2,3-difluorobenzene |
|---|---|
| PubChem CID | 20705608 |
| Molecular Formula | C26H32F4O |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-4-ethyl-2,3-difluorobenzene |
| SMILES | CCCCCC1CCC(c2ccc(C(F)(F)Oc3ccc(CC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C26H32F4O/c1-3-5-6-7-18-8-10-20(11-9-18)21-12-15-22(16-13-21)26(29,30)31-23-17-14-19(4-2)24(27)25(23)28/h12-18,20H,3-11H2,1-2H3 |
| InChIKey | QGPSVETUYUPWDR-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|