C19H23F2N — CID 19695304
4-[4-[(E)-6,6-difluorohex-2-enyl]cyclohexyl]benzonitrile (PubChem CID 19695304) has the molecular formula C19H23F2N and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-[4-[(E)-6,6-difluorohex-2-enyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[(E)-6,6-difluorohex-2-enyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19695304 |
| Molecular Formula | C19H23F2N |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4-[4-[(E)-6,6-difluorohex-2-enyl]cyclohexyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCC(C/C=C/CCC(F)F)CC2)cc1 |
| InChI | InChI=1S/C19H23F2N/c20-19(21)5-3-1-2-4-15-6-10-17(11-7-15)18-12-8-16(14-22)9-13-18/h1-2,8-9,12-13,15,17,19H,3-7,10-11H2/b2-1+ |
| InChIKey | CLKZCJAKFGVQIQ-OWOJBTEDSA-N |
| XLogP | 5.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|