C18H21FO2 — CID 18689105
(2E,4E)-6-[4-(4-fluorophenyl)cyclohexyl]hexa-2,4-dienoic acid (PubChem CID 18689105) has the molecular formula C18H21FO2 and a molecular weight of 288.36 g/mol. Its IUPAC name is (2E,4E)-6-[4-(4-fluorophenyl)cyclohexyl]hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-6-[4-(4-fluorophenyl)cyclohexyl]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 18689105 |
| Molecular Formula | C18H21FO2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2E,4E)-6-[4-(4-fluorophenyl)cyclohexyl]hexa-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C=C/CC1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H21FO2/c19-17-12-10-16(11-13-17)15-8-6-14(7-9-15)4-2-1-3-5-18(20)21/h1-3,5,10-15H,4,6-9H2,(H,20,21)/b2-1+,5-3+ |
| InChIKey | RIURWVJDBUVCDI-NRNIAZNESA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|