C25H37FO4 — CID 118594091
(4-propylphenyl) 4-[2-(5-fluoro-5-propyl-1,3-dioxan-2-yl)ethyl]cyclohexane-1-carboxylate (PubChem CID 118594091) has the molecular formula C25H37FO4 and a molecular weight of 420.57 g/mol. Its IUPAC name is (4-propylphenyl) 4-[2-(5-fluoro-5-propyl-1,3-dioxan-2-yl)ethyl]cyclohexane-1-carboxylate.
| Compound Name | (4-propylphenyl) 4-[2-(5-fluoro-5-propyl-1,3-dioxan-2-yl)ethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118594091 |
| Molecular Formula | C25H37FO4 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (4-propylphenyl) 4-[2-(5-fluoro-5-propyl-1,3-dioxan-2-yl)ethyl]cyclohexane-1-carboxylate |
| SMILES | CCCc1ccc(OC(=O)C2CCC(CCC3OCC(F)(CCC)CO3)CC2)cc1 |
| InChI | InChI=1S/C25H37FO4/c1-3-5-19-8-13-22(14-9-19)30-24(27)21-11-6-20(7-12-21)10-15-23-28-17-25(26,16-4-2)18-29-23/h8-9,13-14,20-21,23H,3-7,10-12,15-18H2,1-2H3 |
| InChIKey | REXHHXJEXFNKML-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|