C21H31ClO2Si — CID 154421083
(4-chlorophenyl) 4-(1-propylsilinan-4-yl)cyclohexane-1-carboxylate (PubChem CID 154421083) has the molecular formula C21H31ClO2Si and a molecular weight of 379.02 g/mol. Its IUPAC name is (4-chlorophenyl) 4-(1-propylsilinan-4-yl)cyclohexane-1-carboxylate.
| Compound Name | (4-chlorophenyl) 4-(1-propylsilinan-4-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 154421083 |
| Molecular Formula | C21H31ClO2Si |
| Molecular Weight | 379.02 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (4-chlorophenyl) 4-(1-propylsilinan-4-yl)cyclohexane-1-carboxylate |
| SMILES | CCC[SiH]1CCC(C2CCC(C(=O)Oc3ccc(Cl)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H31ClO2Si/c1-2-13-25-14-11-17(12-15-25)16-3-5-18(6-4-16)21(23)24-20-9-7-19(22)8-10-20/h7-10,16-18,25H,2-6,11-15H2,1H3 |
| InChIKey | KRYXUNVUGLXNMG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.02 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|