C26H30ClFO2 — CID 22384926
(4-chlorophenyl) 3-fluoro-4-(6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 22384926) has the molecular formula C26H30ClFO2 and a molecular weight of 428.98 g/mol. Its IUPAC name is (4-chlorophenyl) 3-fluoro-4-(6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | (4-chlorophenyl) 3-fluoro-4-(6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 22384926 |
| Molecular Formula | C26H30ClFO2 |
| Molecular Weight | 428.98 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (4-chlorophenyl) 3-fluoro-4-(6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | CCCC1CCC2CC(c3ccc(C(=O)Oc4ccc(Cl)cc4)cc3F)CCC2C1 |
| InChI | InChI=1S/C26H30ClFO2/c1-2-3-17-4-5-19-15-20(7-6-18(19)14-17)24-13-8-21(16-25(24)28)26(29)30-23-11-9-22(27)10-12-23/h8-13,16-20H,2-7,14-15H2,1H3 |
| InChIKey | AXQHXIPAEPUXTE-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.98 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|