C26H31FO2 — CID 22385180
(4-ethylphenyl) 3-fluoro-4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 22385180) has the molecular formula C26H31FO2 and a molecular weight of 394.53 g/mol. Its IUPAC name is (4-ethylphenyl) 3-fluoro-4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | (4-ethylphenyl) 3-fluoro-4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 22385180 |
| Molecular Formula | C26H31FO2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (4-ethylphenyl) 3-fluoro-4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | CCc1ccc(OC(=O)c2ccc(C3CCC4CC(C)CCC4C3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H31FO2/c1-3-18-5-11-23(12-6-18)29-26(28)22-10-13-24(25(27)16-22)21-9-8-19-14-17(2)4-7-20(19)15-21/h5-6,10-13,16-17,19-21H,3-4,7-9,14-15H2,1-2H3 |
| InChIKey | JUFNVMOCKGFKQV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|