C18H22FN — CID 70178855
2-fluoro-3-[2-(4-prop-2-enylcyclohexyl)ethyl]benzonitrile (PubChem CID 70178855) has the molecular formula C18H22FN and a molecular weight of 271.38 g/mol. Its IUPAC name is 2-fluoro-3-[2-(4-prop-2-enylcyclohexyl)ethyl]benzonitrile.
| Compound Name | 2-fluoro-3-[2-(4-prop-2-enylcyclohexyl)ethyl]benzonitrile |
|---|---|
| PubChem CID | 70178855 |
| Molecular Formula | C18H22FN |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-fluoro-3-[2-(4-prop-2-enylcyclohexyl)ethyl]benzonitrile |
| SMILES | C=CCC1CCC(CCc2cccc(C#N)c2F)CC1 |
| InChI | InChI=1S/C18H22FN/c1-2-4-14-7-9-15(10-8-14)11-12-16-5-3-6-17(13-20)18(16)19/h2-3,5-6,14-15H,1,4,7-12H2 |
| InChIKey | QEUXJBIQFGXLAE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|