C20H24N2 — CID 70466493
3-(4-prop-2-enylcyclohexyl)-6-propylbenzene-1,2-dicarbonitrile (PubChem CID 70466493) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-(4-prop-2-enylcyclohexyl)-6-propylbenzene-1,2-dicarbonitrile.
| Compound Name | 3-(4-prop-2-enylcyclohexyl)-6-propylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 70466493 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-(4-prop-2-enylcyclohexyl)-6-propylbenzene-1,2-dicarbonitrile |
| SMILES | C=CCC1CCC(c2ccc(CCC)c(C#N)c2C#N)CC1 |
| InChI | InChI=1S/C20H24N2/c1-3-5-15-7-9-17(10-8-15)18-12-11-16(6-4-2)19(13-21)20(18)14-22/h3,11-12,15,17H,1,4-10H2,2H3 |
| InChIKey | FFASRCXKENREEF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|