C26H18F4O2 — CID 139859520
2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-ethynyl-1,3-dioxane (PubChem CID 139859520) has the molecular formula C26H18F4O2 and a molecular weight of 438.42 g/mol. Its IUPAC name is 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-ethynyl-1,3-dioxane.
| Compound Name | 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-ethynyl-1,3-dioxane |
|---|---|
| PubChem CID | 139859520 |
| Molecular Formula | C26H18F4O2 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-[2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]ethyl]-5-ethynyl-1,3-dioxane |
| SMILES | C#CC1COC(CCc2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)OC1 |
| InChI | InChI=1S/C26H18F4O2/c1-2-16-14-31-25(32-15-16)10-5-18-12-23(28)21(24(29)13-18)8-4-17-3-7-20-19(11-17)6-9-22(27)26(20)30/h1,3,6-7,9,11-13,16,25H,5,10,14-15H2 |
| InChIKey | HGEHPLDGZWLGNK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|