C27H24F4 — CID 139884077
1-fluoro-7-heptyl-2-(3,4,5-trifluorophenyl)phenanthrene (PubChem CID 139884077) has the molecular formula C27H24F4 and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-fluoro-7-heptyl-2-(3,4,5-trifluorophenyl)phenanthrene.
| Compound Name | 1-fluoro-7-heptyl-2-(3,4,5-trifluorophenyl)phenanthrene |
|---|---|
| PubChem CID | 139884077 |
| Molecular Formula | C27H24F4 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-fluoro-7-heptyl-2-(3,4,5-trifluorophenyl)phenanthrene |
| SMILES | CCCCCCCc1ccc2c(ccc3c(F)c(-c4cc(F)c(F)c(F)c4)ccc32)c1 |
| InChI | InChI=1S/C27H24F4/c1-2-3-4-5-6-7-17-8-10-20-18(14-17)9-11-23-22(20)13-12-21(26(23)30)19-15-24(28)27(31)25(29)16-19/h8-16H,2-7H2,1H3 |
| InChIKey | LLVWLCKLZYGQBY-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|