C27H20F4O — CID 91201784
6-butyl-2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]naphthalene-1-carbaldehyde (PubChem CID 91201784) has the molecular formula C27H20F4O and a molecular weight of 436.45 g/mol. Its IUPAC name is 6-butyl-2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]naphthalene-1-carbaldehyde.
| Compound Name | 6-butyl-2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 91201784 |
| Molecular Formula | C27H20F4O |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 6-butyl-2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]naphthalene-1-carbaldehyde |
| SMILES | CCCCc1ccc2c(C=O)c(-c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C27H20F4O/c1-2-3-4-16-5-8-20-17(11-16)6-9-21(23(20)15-32)18-7-10-22(24(28)12-18)19-13-25(29)27(31)26(30)14-19/h5-15H,2-4H2,1H3 |
| InChIKey | LBKVFPPXEUKKPU-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|