C25H16F6O — CID 134554724
6-[[4-(4-ethyl-2-fluorophenyl)-2,6-difluorophenoxy]methyl]-1,2,3-trifluoronaphthalene (PubChem CID 134554724) has the molecular formula C25H16F6O and a molecular weight of 446.39 g/mol. Its IUPAC name is 6-[[4-(4-ethyl-2-fluorophenyl)-2,6-difluorophenoxy]methyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[[4-(4-ethyl-2-fluorophenyl)-2,6-difluorophenoxy]methyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 134554724 |
| Molecular Formula | C25H16F6O |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 6-[[4-(4-ethyl-2-fluorophenyl)-2,6-difluorophenoxy]methyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCc1ccc(-c2cc(F)c(OCc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H16F6O/c1-2-13-3-5-17(19(26)8-13)16-10-21(28)25(22(29)11-16)32-12-14-4-6-18-15(7-14)9-20(27)24(31)23(18)30/h3-11H,2,12H2,1H3 |
| InChIKey | AMMCFCDZDNUOBK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|