C25H23F4NO — CID 123829749
2-[4-[2-[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl]ethyl]phenyl]-5-propylpyridine (PubChem CID 123829749) has the molecular formula C25H23F4NO and a molecular weight of 429.46 g/mol. Its IUPAC name is 2-[4-[2-[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl]ethyl]phenyl]-5-propylpyridine.
| Compound Name | 2-[4-[2-[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl]ethyl]phenyl]-5-propylpyridine |
|---|---|
| PubChem CID | 123829749 |
| Molecular Formula | C25H23F4NO |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[4-[2-[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl]ethyl]phenyl]-5-propylpyridine |
| SMILES | CCCc1ccc(-c2ccc(CCc3cc(F)c(OC=CC(F)F)c(F)c3)cc2)nc1 |
| InChI | InChI=1S/C25H23F4NO/c1-2-3-18-8-11-23(30-16-18)20-9-6-17(7-10-20)4-5-19-14-21(26)25(22(27)15-19)31-13-12-24(28)29/h6-16,24H,2-5H2,1H3 |
| InChIKey | LPUXEPXKGQSOJN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|