C19H16F4O3 — CID 123772310
[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl] 4-propylbenzoate (PubChem CID 123772310) has the molecular formula C19H16F4O3 and a molecular weight of 368.33 g/mol. Its IUPAC name is [4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl] 4-propylbenzoate.
| Compound Name | [4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl] 4-propylbenzoate |
|---|---|
| PubChem CID | 123772310 |
| Molecular Formula | C19H16F4O3 |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl] 4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)Oc2cc(F)c(OC=CC(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H16F4O3/c1-2-3-12-4-6-13(7-5-12)19(24)26-14-10-15(20)18(16(21)11-14)25-9-8-17(22)23/h4-11,17H,2-3H2,1H3 |
| InChIKey | MNPJCXZTWYRQOU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|