C20H18F4O — CID 123570903
2-(3,3-difluoroprop-1-enoxy)-1,3-difluoro-5-[2-(4-propylphenyl)ethenyl]benzene (PubChem CID 123570903) has the molecular formula C20H18F4O and a molecular weight of 350.36 g/mol. Its IUPAC name is 2-(3,3-difluoroprop-1-enoxy)-1,3-difluoro-5-[2-(4-propylphenyl)ethenyl]benzene.
| Compound Name | 2-(3,3-difluoroprop-1-enoxy)-1,3-difluoro-5-[2-(4-propylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 123570903 |
| Molecular Formula | C20H18F4O |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-(3,3-difluoroprop-1-enoxy)-1,3-difluoro-5-[2-(4-propylphenyl)ethenyl]benzene |
| SMILES | CCCc1ccc(C=Cc2cc(F)c(OC=CC(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H18F4O/c1-2-3-14-4-6-15(7-5-14)8-9-16-12-17(21)20(18(22)13-16)25-11-10-19(23)24/h4-13,19H,2-3H2,1H3 |
| InChIKey | LNFKPHCSHRBLLO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|