C21H20ClF5O2 — CID 123390177
1-chloro-5-[difluoro-(4-pentylphenyl)methoxy]-2-(3,3-difluoroprop-1-enoxy)-3-fluorobenzene (PubChem CID 123390177) has the molecular formula C21H20ClF5O2 and a molecular weight of 434.83 g/mol. Its IUPAC name is 1-chloro-5-[difluoro-(4-pentylphenyl)methoxy]-2-(3,3-difluoroprop-1-enoxy)-3-fluorobenzene.
| Compound Name | 1-chloro-5-[difluoro-(4-pentylphenyl)methoxy]-2-(3,3-difluoroprop-1-enoxy)-3-fluorobenzene |
|---|---|
| PubChem CID | 123390177 |
| Molecular Formula | C21H20ClF5O2 |
| Molecular Weight | 434.83 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-chloro-5-[difluoro-(4-pentylphenyl)methoxy]-2-(3,3-difluoroprop-1-enoxy)-3-fluorobenzene |
| SMILES | CCCCCc1ccc(C(F)(F)Oc2cc(F)c(OC=CC(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H20ClF5O2/c1-2-3-4-5-14-6-8-15(9-7-14)21(26,27)29-16-12-17(22)20(18(23)13-16)28-11-10-19(24)25/h6-13,19H,2-5H2,1H3 |
| InChIKey | GVJFCCDQXRPJEV-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.83 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|