C26H21F7 — CID 59247083
2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-difluoro-5-(4-pentylphenyl)benzene (PubChem CID 59247083) has the molecular formula C26H21F7 and a molecular weight of 466.44 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-difluoro-5-(4-pentylphenyl)benzene.
| Compound Name | 2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-difluoro-5-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 59247083 |
| Molecular Formula | C26H21F7 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-difluoro-5-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2cc(F)c(-c3cc(F)c(/C=C/C(F)(F)F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H21F7/c1-2-3-4-5-16-6-8-17(9-7-16)18-12-23(29)25(24(30)13-18)19-14-21(27)20(22(28)15-19)10-11-26(31,32)33/h6-15H,2-5H2,1H3/b11-10+ |
| InChIKey | KZGRGSCRCKGIEX-ZHACJKMWSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|