C20H19F5 — CID 89134649
1,3-difluoro-5-[4-(4-methylphenyl)butyl]-2-(3,3,3-trifluoroprop-1-enyl)benzene (PubChem CID 89134649) has the molecular formula C20H19F5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-(4-methylphenyl)butyl]-2-(3,3,3-trifluoroprop-1-enyl)benzene.
| Compound Name | 1,3-difluoro-5-[4-(4-methylphenyl)butyl]-2-(3,3,3-trifluoroprop-1-enyl)benzene |
|---|---|
| PubChem CID | 89134649 |
| Molecular Formula | C20H19F5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1,3-difluoro-5-[4-(4-methylphenyl)butyl]-2-(3,3,3-trifluoroprop-1-enyl)benzene |
| SMILES | Cc1ccc(CCCCc2cc(F)c(C=CC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H19F5/c1-14-6-8-15(9-7-14)4-2-3-5-16-12-18(21)17(19(22)13-16)10-11-20(23,24)25/h6-13H,2-5H2,1H3 |
| InChIKey | QUDDJIRVVJFAMO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|