C28H21F7 — CID 59246800
2-[2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]ethynyl]-1,3-difluoro-5-(4-pentylphenyl)benzene (PubChem CID 59246800) has the molecular formula C28H21F7 and a molecular weight of 490.46 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]ethynyl]-1,3-difluoro-5-(4-pentylphenyl)benzene.
| Compound Name | 2-[2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]ethynyl]-1,3-difluoro-5-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 59246800 |
| Molecular Formula | C28H21F7 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]ethynyl]-1,3-difluoro-5-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2cc(F)c(C#Cc3cc(F)c(/C=C/C(F)(F)F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H21F7/c1-2-3-4-5-18-6-9-20(10-7-18)21-16-26(31)22(27(32)17-21)11-8-19-14-24(29)23(25(30)15-19)12-13-28(33,34)35/h6-7,9-10,12-17H,2-5H2,1H3/b13-12+ |
| InChIKey | XZMVUBIBSSBUKI-OUKQBFOZSA-N |
| XLogP | 8.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|