C33H30F8O2 — CID 59246936
[4-[4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3,5-difluorophenyl]-3-fluorophenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 59246936) has the molecular formula C33H30F8O2 and a molecular weight of 610.59 g/mol. Its IUPAC name is [4-[4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3,5-difluorophenyl]-3-fluorophenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [4-[4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3,5-difluorophenyl]-3-fluorophenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59246936 |
| Molecular Formula | C33H30F8O2 |
| Molecular Weight | 610.59 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | [4-[4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3,5-difluorophenyl]-3-fluorophenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(-c3cc(F)c(-c4cc(F)c(/C=C/C(F)(F)F)c(F)c4)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C33H30F8O2/c1-2-3-4-5-19-6-8-20(9-7-19)32(42)43-23-10-11-24(28(36)18-23)21-14-29(37)31(30(38)15-21)22-16-26(34)25(27(35)17-22)12-13-33(39,40)41/h10-20H,2-9H2,1H3/b13-12+ |
| InChIKey | ROXROKBOGWQLPB-OUKQBFOZSA-N |
| XLogP | 10.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.59 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|