C25H32F6O2 — CID 22079999
1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[(E)-2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]ethenyl]benzene (PubChem CID 22079999) has the molecular formula C25H32F6O2 and a molecular weight of 478.52 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[(E)-2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]ethenyl]benzene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[(E)-2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]ethenyl]benzene |
|---|---|
| PubChem CID | 22079999 |
| Molecular Formula | C25H32F6O2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[(E)-2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]ethenyl]benzene |
| SMILES | COCC1CCC(C2CCC(/C=C/c3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H32F6O2/c1-32-16-19-6-12-21(13-7-19)20-10-4-17(5-11-20)2-3-18-8-14-22(15-9-18)33-25(30,31)23(26)24(27,28)29/h2-3,8-9,14-15,17,19-21,23H,4-7,10-13,16H2,1H3/b3-2+ |
| InChIKey | BJORNYNOHICUCJ-NSCUHMNNSA-N |
| XLogP | 7.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |