C14H12F6O2S — CID 169458374
S-[3-[4-[(2S)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]prop-2-enyl] ethanethioate (PubChem CID 169458374) has the molecular formula C14H12F6O2S and a molecular weight of 358.30 g/mol. Its IUPAC name is S-[3-[4-[(2S)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[4-[(2S)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169458374 |
| Molecular Formula | C14H12F6O2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | S-[3-[4-[(2S)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1ccc(OC(F)(F)[C@H](F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F6O2S/c1-9(21)23-8-2-3-10-4-6-11(7-5-10)22-14(19,20)12(15)13(16,17)18/h2-7,12H,8H2,1H3/t12-/m1/s1 |
| InChIKey | RWHGMHUGIGUEDP-GFCCVEGCSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|