C22H25FO — CID 19780966
1-[4-[(E)-2-fluoroethenyl]cyclohexyl]-4-[4-(methoxymethyl)phenyl]benzene (PubChem CID 19780966) has the molecular formula C22H25FO and a molecular weight of 324.44 g/mol. Its IUPAC name is 1-[4-[(E)-2-fluoroethenyl]cyclohexyl]-4-[4-(methoxymethyl)phenyl]benzene.
| Compound Name | 1-[4-[(E)-2-fluoroethenyl]cyclohexyl]-4-[4-(methoxymethyl)phenyl]benzene |
|---|---|
| PubChem CID | 19780966 |
| Molecular Formula | C22H25FO |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-[4-[(E)-2-fluoroethenyl]cyclohexyl]-4-[4-(methoxymethyl)phenyl]benzene |
| SMILES | COCc1ccc(-c2ccc(C3CCC(/C=C/F)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H25FO/c1-24-16-18-4-8-20(9-5-18)22-12-10-21(11-13-22)19-6-2-17(3-7-19)14-15-23/h4-5,8-15,17,19H,2-3,6-7,16H2,1H3/b15-14+ |
| InChIKey | LXWBEDUXTNWXRV-CCEZHUSRSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |