C20H34F6O2S — CID 173376097
(2-fluorophenyl)sulfanyl 4-heptylcyclohexane-1-carboxylate;pentahydrofluoride (PubChem CID 173376097) has the molecular formula C20H34F6O2S and a molecular weight of 452.55 g/mol. Its IUPAC name is (2-fluorophenyl)sulfanyl 4-heptylcyclohexane-1-carboxylate;pentahydrofluoride.
| Compound Name | (2-fluorophenyl)sulfanyl 4-heptylcyclohexane-1-carboxylate;pentahydrofluoride |
|---|---|
| PubChem CID | 173376097 |
| Molecular Formula | C20H34F6O2S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (2-fluorophenyl)sulfanyl 4-heptylcyclohexane-1-carboxylate;pentahydrofluoride |
| SMILES | CCCCCCCC1CCC(C(=O)OSc2ccccc2F)CC1.F.F.F.F.F |
| InChI | InChI=1S/C20H29FO2S.5FH/c1-2-3-4-5-6-9-16-12-14-17(15-13-16)20(22)23-24-19-11-8-7-10-18(19)21;;;;;/h7-8,10-11,16-17H,2-6,9,12-15H2,1H3;5*1H |
| InChIKey | VOLQDLQIELIRMM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|