About (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride
(2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride (PubChem CID 19993144) has the molecular formula C19H21F6O3S-5
and a molecular weight of 443.43 g/mol. Its IUPAC name is (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride.
Molecular Properties
| Compound Name | (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride |
| PubChem CID | 19993144 |
| Molecular Formula | C19H21F6O3S-5 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride |
| SMILES | CCCCCCOc1ccc(C(=O)OSc2ccccc2F)cc1.[F-].[F-].[F-].[F-].[F-] |
| InChI | InChI=1S/C19H21FO3S.5FH/c1-2-3-4-7-14-22-16-12-10-15(11-13-16)19(21)23-24-18-9-6-5-8-17(18)20;;;;;/h5-6,8-13H,2-4,7,14H2,1H3;5*1H/p-5 |
| InChIKey | HJYDMGFPILELRR-UHFFFAOYSA-I |
| XLogP | -9.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | -9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride?
The IUPAC name of (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride (CID 19993144) is (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride.
What is the SMILES notation for (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride?
The canonical SMILES for (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride is CCCCCCOc1ccc(C(=O)OSc2ccccc2F)cc1.[F-].[F-].[F-].[F-].[F-].
What is the InChIKey of (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride?
The InChIKey is HJYDMGFPILELRR-UHFFFAOYSA-I. The full InChI is InChI=1S/C19H21FO3S.5FH/c1-2-3-4-7-14-22-16-12-10-15(11-13-16)19(21)23-24-18-9-6-5-8-17(18)20;;;;;/h5-6,8-13H,2-4,7,14H2,1H3;5*1H/p-5.
What are the key properties of (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride?
(2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride has a molecular weight of 443.43 g/mol, XLogP of -9.33, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)sulfanyl 4-hexoxybenzoate pentafluoride is sourced from PubChem (CID 19993144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).