About (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride
(2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride (PubChem CID 173376195) has the molecular formula C18H24F6O3S
and a molecular weight of 434.44 g/mol. Its IUPAC name is (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride.
Molecular Properties
| Compound Name | (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride |
| PubChem CID | 173376195 |
| Molecular Formula | C18H24F6O3S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride |
| SMILES | CCCCCOc1ccc(C(=O)OSc2ccccc2F)cc1.F.F.F.F.F |
| InChI | InChI=1S/C18H19FO3S.5FH/c1-2-3-6-13-21-15-11-9-14(10-12-15)18(20)22-23-17-8-5-4-7-16(17)19;;;;;/h4-5,7-12H,2-3,6,13H2,1H3;5*1H |
| InChIKey | WGTBJFMLKPIKQL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride?
The IUPAC name of (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride (CID 173376195) is (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride.
What is the SMILES notation for (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride?
The canonical SMILES for (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride is CCCCCOc1ccc(C(=O)OSc2ccccc2F)cc1.F.F.F.F.F.
What is the InChIKey of (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride?
The InChIKey is WGTBJFMLKPIKQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FO3S.5FH/c1-2-3-6-13-21-15-11-9-14(10-12-15)18(20)22-23-17-8-5-4-7-16(17)19;;;;;/h4-5,7-12H,2-3,6,13H2,1H3;5*1H.
What are the key properties of (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride?
(2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride has a molecular weight of 434.44 g/mol, XLogP of 6.02, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)sulfanyl 4-pentoxybenzoate;pentahydrofluoride is sourced from PubChem (CID 173376195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).