C54H70O4 — CID 54548965
[(1R,2R)-1,2-diphenyl-2-[4-[4-(4-propylcyclohexyl)butyl]benzoyl]oxyethyl] 4-[4-(4-propylcyclohexyl)butyl]benzoate (PubChem CID 54548965) has the molecular formula C54H70O4 and a molecular weight of 783.15 g/mol. Its IUPAC name is [(1R,2R)-1,2-diphenyl-2-[4-[4-(4-propylcyclohexyl)butyl]benzoyl]oxyethyl] 4-[4-(4-propylcyclohexyl)butyl]benzoate.
| Compound Name | [(1R,2R)-1,2-diphenyl-2-[4-[4-(4-propylcyclohexyl)butyl]benzoyl]oxyethyl] 4-[4-(4-propylcyclohexyl)butyl]benzoate |
|---|---|
| PubChem CID | 54548965 |
| Molecular Formula | C54H70O4 |
| Molecular Weight | 783.15 g/mol |
| Exact Mass | 782.53 |
| IUPAC Name | [(1R,2R)-1,2-diphenyl-2-[4-[4-(4-propylcyclohexyl)butyl]benzoyl]oxyethyl] 4-[4-(4-propylcyclohexyl)butyl]benzoate |
| SMILES | CCCC1CCC(CCCCc2ccc(C(=O)O[C@H](c3ccccc3)[C@H](OC(=O)c3ccc(CCCCC4CCC(CCC)CC4)cc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C54H70O4/c1-3-15-41-25-29-43(30-26-41)17-11-13-19-45-33-37-49(38-34-45)53(55)57-51(47-21-7-5-8-22-47)52(48-23-9-6-10-24-48)58-54(56)50-39-35-46(36-40-50)20-14-12-18-44-31-27-42(16-4-2)28-32-44/h5-10,21-24,33-44,51-52H,3-4,11-20,25-32H2,1-2H3/t41?,42?,43?,44?,51-,52-/m1/s1 |
| InChIKey | ZIOJYMABCXNWAN-FUIXJKIYSA-N |
| XLogP | 14.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.15 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|