C42H48O4P2 — CID 22090398
[1,2-diphenyl-2-[4-[4-(phosphanylmethyl)cyclohexyl]benzoyl]oxyethyl] 4-[4-(phosphanylmethyl)cyclohexyl]benzoate (PubChem CID 22090398) has the molecular formula C42H48O4P2 and a molecular weight of 678.79 g/mol. Its IUPAC name is [1,2-diphenyl-2-[4-[4-(phosphanylmethyl)cyclohexyl]benzoyl]oxyethyl] 4-[4-(phosphanylmethyl)cyclohexyl]benzoate.
| Compound Name | [1,2-diphenyl-2-[4-[4-(phosphanylmethyl)cyclohexyl]benzoyl]oxyethyl] 4-[4-(phosphanylmethyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 22090398 |
| Molecular Formula | C42H48O4P2 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.30 |
| IUPAC Name | [1,2-diphenyl-2-[4-[4-(phosphanylmethyl)cyclohexyl]benzoyl]oxyethyl] 4-[4-(phosphanylmethyl)cyclohexyl]benzoate |
| SMILES | O=C(OC(c1ccccc1)C(OC(=O)c1ccc(C2CCC(CP)CC2)cc1)c1ccccc1)c1ccc(C2CCC(CP)CC2)cc1 |
| InChI | InChI=1S/C42H48O4P2/c43-41(37-23-19-33(20-24-37)31-15-11-29(27-47)12-16-31)45-39(35-7-3-1-4-8-35)40(36-9-5-2-6-10-36)46-42(44)38-25-21-34(22-26-38)32-17-13-30(28-48)14-18-32/h1-10,19-26,29-32,39-40H,11-18,27-28,47-48H2 |
| InChIKey | SZFJXKAQZCRSHB-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|