C40H42O8 — CID 21036021
[2-phenyl-2-[4-(4-prop-2-enoyloxycyclohexyl)benzoyl]oxyethyl] 4-(4-prop-2-enoyloxycyclohexyl)benzoate (PubChem CID 21036021) has the molecular formula C40H42O8 and a molecular weight of 650.77 g/mol. Its IUPAC name is [2-phenyl-2-[4-(4-prop-2-enoyloxycyclohexyl)benzoyl]oxyethyl] 4-(4-prop-2-enoyloxycyclohexyl)benzoate.
| Compound Name | [2-phenyl-2-[4-(4-prop-2-enoyloxycyclohexyl)benzoyl]oxyethyl] 4-(4-prop-2-enoyloxycyclohexyl)benzoate |
|---|---|
| PubChem CID | 21036021 |
| Molecular Formula | C40H42O8 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | [2-phenyl-2-[4-(4-prop-2-enoyloxycyclohexyl)benzoyl]oxyethyl] 4-(4-prop-2-enoyloxycyclohexyl)benzoate |
| SMILES | C=CC(=O)OC1CCC(c2ccc(C(=O)OCC(OC(=O)c3ccc(C4CCC(OC(=O)C=C)CC4)cc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C40H42O8/c1-3-37(41)46-34-22-18-29(19-23-34)27-10-14-32(15-11-27)39(43)45-26-36(31-8-6-5-7-9-31)48-40(44)33-16-12-28(13-17-33)30-20-24-35(25-21-30)47-38(42)4-2/h3-17,29-30,34-36H,1-2,18-26H2 |
| InChIKey | REFKFYKBQFROOB-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|